Profenofos
| Specification | |
| Active Ingredient | 94% min. |
| Appearance |
light-yellow |
| Physical and chemical properties | |
| Chemical Name |
O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate |
| Empirical Formula |
C11H15BrClO3PS |
| Molecular Weight |
373.65 |
| Structural Formula |
|
| Melting point |
1.455 (20 ºC) (OECD 109) |
| Solubility |
In water 20 mg/litre at 20°C; 25 mg/litre at 25°C.Readily miscible with most organic solvents. |
| Vapor pressure | 1.24 x 10-1 mPa (25 ºC) |
| Formulations |
|
94%TC, 40%EC
|
| Application |
|
Non-systemic insecticide and acaricide with contact and stomach action. Exhibits a translaminar effect. Has ovicidal properties. Control of insects (particularly Lepidoptera) and mites on cotton, maize, sugar beet, soya beans, potatoes, vegetables, tobacco, and other crops, at 250-1000 g/ha.
|