Profenofos + Cypermethrin
| Specification | |
| Active Ingredient | Profenofos 40% +Cypermethrin 4% |
| Appearance | light-yellow |
| Physical and chemical properties | |
| Chemical Name |
Profenofos: O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate Cypermethrin:(R,S)-alpha-cyano-3-phenoxybenzyl(1RS)-cis,trans-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropane-carboxylate |
| Empirical Formula |
Profenofos: C11H15BrClO3PS Cypermethrin: C22H19Cl2NO3 |
| Molecular Weight |
Profenofos: 373.65 Cypermethrin: 416.3 |
| Structural Formula |
|
| Melting point |
1.117 (20 ºC) |
| Solubility |
Profenofos: In water 20 mg/litre at 20°C; 25 mg/litre at 25°C.Readily miscible with most organic solvents. Cypermethrin: solubility in water (20C): 0.009 mg/litre (WHO 1989); in organic solvents:hexane 103 g/litre, xylene Greater than 450 g/litre; solubility in cyclohexane, ethanol, acetone, and chloroform (WHO 1989). |
| Vapor pressure |
2.5 x 10-5 mPa (25 ºC). |
| Formulations |
|
Profenofos 40% + Cypermethrin 4% EC
|
| Application |
|
|
